Naphterpin
| Internal ID | 957577de-22ce-40a1-bce2-70fec9cb0252 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (4aS,12bR)-8,10-dihydroxy-2,5,5,9-tetramethyl-3,4,4a,12b-tetrahydronaphtho[2,3-c]isochromene-7,12-dione |
| SMILES (Canonical) | CC1=CC2C(CC1)C(OC3=C2C(=O)C4=CC(=C(C(=C4C3=O)O)C)O)(C)C |
| SMILES (Isomeric) | CC1=C[C@@H]2[C@H](CC1)C(OC3=C2C(=O)C4=CC(=C(C(=C4C3=O)O)C)O)(C)C |
| InChI | InChI=1S/C21H22O5/c1-9-5-6-13-11(7-9)16-18(24)12-8-14(22)10(2)17(23)15(12)19(25)20(16)26-21(13,3)4/h7-8,11,13,22-23H,5-6H2,1-4H3/t11-,13+/m1/s1 |
| InChI Key | GTEXXGIEZVKSLH-YPMHNXCESA-N |
| Popularity | 26 references in papers |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 3.70 |
| 128505-88-4 |
| (4aS,12bR)-8,10-dihydroxy-2,5,5,9-tetramethyl-3,4,4a,12b-tetrahydronaphtho[2,3-c]isochromene-7,12-dione |
| (4aS-cis)-3,4a,5,12b-Tetrahydro-8,10-dihydroxy-2,5,5,9-tetramethyl-4H-benzo(d)naphtho(2,3-b)pyran-7,12-dione |
| 4H-Benzo(d)naphtho(2,3-b)pyran-7,12-dione, 3,4a,5,12b-tetrahydro-8,10-dihydroxy-2,5,5,9-tetramethyl- |
| NSC640155 |
| DTXSID30155916 |
| NSC-640155 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.03% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.43% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.74% | 96.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.67% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.59% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.89% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.87% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.65% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.21% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.92% | 92.94% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.58% | 91.38% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.79% | 96.21% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.52% | 96.77% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.97% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.81% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.73% | 96.43% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.98% | 93.40% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.33% | 94.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.13% | 80.96% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.81% | 85.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.55% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.41% | 93.18% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.62% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 124960 |
| LOTUS | LTS0237491 |
| wikiData | Q83023906 |