Naloxone
| Internal ID | 4316c49f-7c71-4bd3-bd99-a3fec175a0ee |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives |
| IUPAC Name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES (Canonical) | C=CCN1CCC23C4C(=O)CCC2(C1CC5=C3C(=C(C=C5)O)O4)O |
| SMILES (Isomeric) | C=CCN1CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)O)O4)O |
| InChI | InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1 |
| InChI Key | UZHSEJADLWPNLE-GRGSLBFTSA-N |
| Popularity | 35,724 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 2.10 |
| Atomic LogP (AlogP) | 1.30 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 2 |
| 465-65-6 |
| l-Naloxone |
| n-Allylnoroxymorphone |
| (-)-Naloxone |
| Naloxona |
| EN 1530 base |
| Naloxonum |
| Nalossone |
| N-Allyl-noroxymorphone |
| DBL Naloxone |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9761 | 97.61% |
| Caco-2 | + | 0.5706 | 57.06% |
| Blood Brain Barrier | + | 1.0000 | 100.00% |
| Human oral bioavailability | - | 0.9857 | 98.57% |
| Subcellular localzation | Mitochondria | 0.5800 | 58.00% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9398 | 93.98% |
| OATP1B3 inhibitior | + | 0.9492 | 94.92% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9099 | 90.99% |
| BSEP inhibitior | - | 0.9231 | 92.31% |
| P-glycoprotein inhibitior | - | 0.9215 | 92.15% |
| P-glycoprotein substrate | - | 0.8666 | 86.66% |
| CYP3A4 substrate | + | 0.5846 | 58.46% |
| CYP2C9 substrate | - | 0.8108 | 81.08% |
| CYP2D6 substrate | + | 0.5350 | 53.50% |
| CYP3A4 inhibition | - | 0.9153 | 91.53% |
| CYP2C9 inhibition | - | 0.9303 | 93.03% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.7886 | 78.86% |
| CYP1A2 inhibition | - | 0.9046 | 90.46% |
| CYP2C8 inhibition | - | 0.8770 | 87.70% |
| CYP inhibitory promiscuity | - | 0.9523 | 95.23% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.5181 | 51.81% |
| Eye corrosion | - | 0.9904 | 99.04% |
| Eye irritation | - | 0.9683 | 96.83% |
| Skin irritation | - | 0.7669 | 76.69% |
| Skin corrosion | - | 0.9262 | 92.62% |
| Ames mutagenesis | - | 0.6654 | 66.54% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5888 | 58.88% |
| Micronuclear | + | 0.6400 | 64.00% |
| Hepatotoxicity | - | 1.0000 | 100.00% |
| skin sensitisation | - | 0.6975 | 69.75% |
| Respiratory toxicity | + | 0.9778 | 97.78% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 1.0000 | 100.00% |
| Nephrotoxicity | - | 0.8242 | 82.42% |
| Acute Oral Toxicity (c) | III | 0.6217 | 62.17% |
| Estrogen receptor binding | - | 0.8681 | 86.81% |
| Androgen receptor binding | + | 0.5299 | 52.99% |
| Thyroid receptor binding | - | 0.5341 | 53.41% |
| Glucocorticoid receptor binding | + | 0.6619 | 66.19% |
| Aromatase binding | + | 0.5635 | 56.35% |
| PPAR gamma | + | 0.6057 | 60.57% |
| Honey bee toxicity | - | 0.7932 | 79.32% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
| Fish aquatic toxicity | + | 0.6627 | 66.27% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
1.6 nM |
IC50 |
PMID: 16250647
|
| CHEMBL289 | P10635 | Cytochrome P450 2D6 |
2000 nM |
IC50 |
via CMAUP
|
| CHEMBL236 | P41143 | Delta opioid receptor |
21.38 nM 138 nM 138 nM 138 nM 138 nM 151 nM |
Ki IC50 IC50 IC50 IC50 IC50 |
via Super-PRED
PMID: 18039010 PMID: 17451272 PMID: 17388627 PMID: 16989522 PMID: 11585443 |
| CHEMBL237 | P41145 | Kappa opioid receptor |
500 nM 1.5 nM 0.25 nM 75 nM 49.8 nM |
IC50 IC50 Ki IC50 IC50 |
via Super-PRED
PMID: 11585443 via Super-PRED via CMAUP PMID: 12747782 |
| CHEMBL233 | P35372 | Mu opioid receptor |
0.2188 nM 1.87 nM 7.3 nM 7.3 nM 7.3 nM 7.3 nM 2 nM |
Kd IC50 IC50 IC50 IC50 IC50 IC50 |
via Super-PRED
PMID: 24171469 PMID: 18313920 PMID: 17149859 PMID: 17149858 PMID: 14643346 PMID: 11585443 |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
10 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 95.68% | 93.40% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.19% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.69% | 93.99% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 93.66% | 95.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.33% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.06% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.73% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.33% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.09% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.04% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.01% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.50% | 93.04% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.00% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Papaver somniferum |