Nagilactone D
Internal ID | 5f2e434e-1e60-44a6-90d7-e18e37d822a8 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,2S,4R,5R,6R,9R,17R)-12-ethyl-5-hydroxy-1,6-dimethyl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-11,15-diene-7,14-dione |
SMILES (Canonical) | CCC1=C2CC3C4C(C(C5C(C4(C2=CC(=O)O1)C)O5)O)(C(=O)O3)C |
SMILES (Isomeric) | CCC1=C2C[C@@H]3[C@H]4[C@]([C@H]([C@@H]5[C@H]([C@@]4(C2=CC(=O)O1)C)O5)O)(C(=O)O3)C |
InChI | InChI=1S/C18H20O6/c1-4-9-7-5-10-13-17(2,8(7)6-11(19)22-9)15-12(24-15)14(20)18(13,3)16(21)23-10/h6,10,12-15,20H,4-5H2,1-3H3/t10-,12-,13-,14+,15-,17-,18-/m1/s1 |
InChI Key | UEZYUDAMQBJVJP-CQVMLLNQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H20O6 |
Molecular Weight | 332.30 g/mol |
Exact Mass | 332.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 85.40 Ų |
XlogP | 0.60 |
19891-53-3 |
CHEMBL4217857 |
DTXSID60173668 |
3H,8H-Furo(2',3',4':4,5)oxireno(7,8)naphtho(2,1-c)pyran-3,8-dione, 6-ethyl-1a.2.2a.4a.4b.5.9b.9c-octahydro-2-hydroxy-2,9-dimethyl-, (1aR,2R,2aR,4aR,4bR,9bS,9cS)- |
3H,8H-Furo(2',3',4':4,5)oxireno(7,8)naphtho(2,1-c)pyran-3,8-dione, 6-ethyl-1aalpha,2,2a,4abeta,4bbeta,5,9b,9calpha-octahydro-2alpha-hydroxy-2abeta,9balpha-dimethyl-, (+)- |
Podolactone B, 7,8-deepoxy-8,14-didehydro-15-de(hydroxymethyl)-15-deoxy-, (1alpha,2alpha)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.94% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.59% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.34% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.76% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.01% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.92% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.17% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.62% | 89.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.99% | 85.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.88% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.95% | 92.62% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.39% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.24% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.02% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Afrocarpus gracilior |
Nageia nagi |
Nageia wallichiana |
PubChem | 3084330 |
LOTUS | LTS0101482 |
wikiData | Q83043714 |