Nagilactone
Internal ID | c693e287-b52c-4e33-a88d-5ed7351134ad |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | 5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-11,15-diene-7,14-dione |
SMILES (Canonical) | CC(C)C1=C2C(C3C4C(C(C5C(C4(C2=CC(=O)O1)C)O5)O)(C(=O)O3)C)O |
SMILES (Isomeric) | CC(C)C1=C2C(C3C4C(C(C5C(C4(C2=CC(=O)O1)C)O5)O)(C(=O)O3)C)O |
InChI | InChI=1S/C19H22O7/c1-6(2)11-9-7(5-8(20)24-11)18(3)14-12(10(9)21)26-17(23)19(14,4)15(22)13-16(18)25-13/h5-6,10,12-16,21-22H,1-4H3 |
InChI Key | DGNOPGIIPQKNHD-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C19H22O7 |
Molecular Weight | 362.40 g/mol |
Exact Mass | 362.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 106.00 Ų |
XlogP | -0.20 |
5,10-Dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.7.1.02,4.06,17.011,16]heptadeca-11,15-diene-7,14-dione |
NSC211500 |
NSC-211500 |
Neuro_000110 |
CHEMBL176006 |
BDBM50044557 |
NAGILACTONE C (RICE UNIVERSITY) |
Podolactone B,8-deepoxy-8,14-didehydro-15,16-dideoxy-7-hydroxy-, (7.beta.)- |
(1S,2S,4R,5R,6R,9S,10R,17R)-5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.7.1.0^{2,4.0^{6,17.0^{11,16]heptadeca-11,15-diene-7,14-dione |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.92% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.78% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.67% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.65% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.64% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.32% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.18% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.95% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.31% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.56% | 96.09% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.72% | 85.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.55% | 85.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.16% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Afrocarpus gracilior |
Nageia nagi |
Podocarpus fasciculus |
PubChem | 319648 |
LOTUS | LTS0224928 |
wikiData | Q104978930 |