N(5)-phenyl-L-glutamine
| Internal ID | fd04d391-ca2b-451c-82c0-da782e6deb1f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamine and derivatives |
| IUPAC Name | (2S)-2-amino-5-anilino-5-oxopentanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H14N2O3/c12-9(11(15)16)6-7-10(14)13-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChI Key | VMNRUJGOLBSEPK-VIFPVBQESA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10044231 g/mol |
| Topological Polar Surface Area (TPSA) | 92.40 Ų |
| XlogP | -2.10 |
| 5963-60-0 |
| N(5)-phenyl-L-glutamine |
| (2S)-2-amino-5-anilino-5-oxopentanoic acid |
| N-Phenyl-L-glutamine |
| L-gamma-glutamylaniline |
| gamma-glutamylanilide |
| (S)-2-Amino-5-oxo-5-(phenylamino)pentanoic acid |
| H-Gln(Ph)-OH |
| L-Glutamic acid gamma-anilide |
| N5-phenyl-L-glutamine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.86% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.58% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.23% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.70% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.10% | 94.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.67% | 94.73% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.19% | 92.29% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.69% | 99.23% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.49% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.36% | 100.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.73% | 94.08% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.55% | 97.21% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.58% | 95.48% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.24% | 91.65% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.11% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 18603770 |
| LOTUS | LTS0136881 |
| wikiData | Q27147791 |