N(1)Gly-Ser-Gln-Leu-Val-Tyr-Arg-DL-Glu(1)-Trp-Val-Gly-His-Ser-Asn-Val-Ile-Lys-Pro-OH
| Internal ID | bc1507bd-82af-4a0b-b36c-e6e2e637895d |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[(5S,8S,11S,14S,17S,20S)-8-(3-amino-3-oxopropyl)-20-(3-carbamimidamidopropyl)-5-(hydroxymethyl)-17-[(4-hydroxyphenyl)methyl]-11-(2-methylpropyl)-3,6,9,12,15,18,21,26-octaoxo-14-propan-2-yl-1,4,7,10,13,16,19,22-octazacyclohexacosane-23-carbonyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-4-oxobutanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O)NC(=O)C(C(C)C)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)C(CC2=CN=CN2)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C5CCC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N5)CCCNC(=N)N)CC6=CC=C(C=C6)O)C(C)C)CC(C)C)CCC(=O)N)CO |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CO)NC(=O)[C@H](CC2=CN=CN2)NC(=O)CNC(=O)[C@H](C(C)C)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)C5CCC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N5)CCCNC(=N)N)CC6=CC=C(C=C6)O)C(C)C)CC(C)C)CCC(=O)N)CO |
| InChI | InChI=1S/C94H143N27O25/c1-11-50(10)77(91(143)111-60(20-14-15-31-95)92(144)121-33-17-22-68(121)93(145)146)120-90(142)76(49(8)9)119-85(137)65(38-70(97)126)114-87(139)67(44-123)116-82(134)64(37-53-40-100-45-105-53)106-73(129)42-104-88(140)74(47(4)5)117-84(136)63(36-52-39-102-56-19-13-12-18-55(52)56)113-80(132)59-28-30-71(127)103-41-72(128)107-66(43-122)86(138)110-58(27-29-69(96)125)79(131)112-61(34-46(2)3)83(135)118-75(48(6)7)89(141)115-62(35-51-23-25-54(124)26-24-51)81(133)108-57(78(130)109-59)21-16-32-101-94(98)99/h12-13,18-19,23-26,39-40,45-50,57-68,74-77,102,122-124H,11,14-17,20-22,27-38,41-44,95H2,1-10H3,(H2,96,125)(H2,97,126)(H,100,105)(H,103,127)(H,104,140)(H,106,129)(H,107,128)(H,108,133)(H,109,130)(H,110,138)(H,111,143)(H,112,131)(H,113,132)(H,114,139)(H,115,141)(H,116,134)(H,117,136)(H,118,135)(H,119,137)(H,120,142)(H,145,146)(H4,98,99,101)/t50-,57-,58-,59?,60-,61-,62-,63-,64-,65-,66-,67-,68-,74-,75-,76-,77-/m0/s1 |
| InChI Key | ZYWDOXCVVHITIW-QFBVMFCQSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C94H143N27O25 |
| Molecular Weight | 2051.30 g/mol |
| Exact Mass | 2051.0781980 g/mol |
| Topological Polar Surface Area (TPSA) | 832.00 Ų |
| XlogP | -4.90 |
| Atomic LogP (AlogP) | -7.42 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 29 |
| Rotatable Bonds | 48 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9456 | 94.56% |
| Caco-2 | - | 0.8607 | 86.07% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Mitochondria | 0.4170 | 41.70% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8006 | 80.06% |
| OATP1B3 inhibitior | + | 0.9339 | 93.39% |
| MATE1 inhibitior | - | 0.7609 | 76.09% |
| OCT2 inhibitior | + | 0.6000 | 60.00% |
| BSEP inhibitior | + | 0.9735 | 97.35% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8766 | 87.66% |
| CYP3A4 substrate | + | 0.7642 | 76.42% |
| CYP2C9 substrate | - | 0.6116 | 61.16% |
| CYP2D6 substrate | - | 0.8321 | 83.21% |
| CYP3A4 inhibition | - | 0.7113 | 71.13% |
| CYP2C9 inhibition | - | 0.8408 | 84.08% |
| CYP2C19 inhibition | - | 0.8170 | 81.70% |
| CYP2D6 inhibition | - | 0.8848 | 88.48% |
| CYP1A2 inhibition | - | 0.8285 | 82.85% |
| CYP2C8 inhibition | + | 0.8680 | 86.80% |
| CYP inhibitory promiscuity | - | 0.9081 | 90.81% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5777 | 57.77% |
| Eye corrosion | - | 0.9855 | 98.55% |
| Eye irritation | - | 0.8952 | 89.52% |
| Skin irritation | - | 0.7814 | 78.14% |
| Skin corrosion | - | 0.9294 | 92.94% |
| Ames mutagenesis | - | 0.7600 | 76.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7254 | 72.54% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | - | 0.5500 | 55.00% |
| skin sensitisation | - | 0.8614 | 86.14% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 1.0000 | 100.00% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | - | 0.8483 | 84.83% |
| Acute Oral Toxicity (c) | III | 0.5376 | 53.76% |
| Estrogen receptor binding | - | 0.5410 | 54.10% |
| Androgen receptor binding | + | 0.6468 | 64.68% |
| Thyroid receptor binding | + | 0.8071 | 80.71% |
| Glucocorticoid receptor binding | + | 0.8341 | 83.41% |
| Aromatase binding | + | 0.8183 | 81.83% |
| PPAR gamma | + | 0.7672 | 76.72% |
| Honey bee toxicity | - | 0.6053 | 60.53% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.8859 | 88.59% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.99% | 98.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.68% | 97.64% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 99.67% | 93.10% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.64% | 97.23% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 99.60% | 96.67% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 99.56% | 98.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.50% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 99.12% | 90.20% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.10% | 96.61% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 99.02% | 88.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.97% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.95% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.92% | 94.66% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.86% | 98.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.44% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.25% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.82% | 82.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 97.03% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.76% | 97.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.74% | 88.42% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 96.68% | 91.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.40% | 99.17% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 96.34% | 88.10% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 96.30% | 98.89% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.25% | 94.45% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 96.03% | 95.00% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 95.73% | 99.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.54% | 82.69% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 95.21% | 96.11% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 95.16% | 96.31% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.12% | 89.63% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.03% | 98.75% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 94.47% | 90.24% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 94.43% | 82.86% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.39% | 98.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.19% | 95.56% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 94.13% | 85.00% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 93.80% | 96.69% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 93.75% | 92.32% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 93.58% | 96.28% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.26% | 95.89% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 92.84% | 96.67% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 92.83% | 95.52% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 92.56% | 95.50% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 92.24% | 100.00% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 92.05% | 97.64% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 91.98% | 96.25% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 91.18% | 89.33% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 91.13% | 97.43% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.06% | 90.71% |
| CHEMBL3468 | P55210 | Caspase-7 | 91.03% | 95.68% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.90% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.69% | 95.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.24% | 95.38% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.03% | 95.83% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 90.02% | 90.65% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.93% | 96.21% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.73% | 97.14% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 89.71% | 96.03% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.70% | 96.85% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.58% | 95.17% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.55% | 95.56% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 89.44% | 99.52% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.21% | 99.23% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.94% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.88% | 96.47% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.72% | 91.38% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.48% | 98.59% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 87.20% | 96.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.90% | 100.00% |
| CHEMBL2821 | P00748 | Coagulation factor XII | 86.66% | 96.21% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.64% | 93.18% |
| CHEMBL236 | P41143 | Delta opioid receptor | 86.40% | 99.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.28% | 99.15% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 86.26% | 99.23% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 86.08% | 92.22% |
| CHEMBL227 | P30556 | Type-1 angiotensin II receptor | 85.74% | 99.53% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.48% | 85.14% |
| CHEMBL1628481 | P35414 | Apelin receptor | 85.32% | 97.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.92% | 93.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.66% | 95.00% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 83.74% | 99.77% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.67% | 83.82% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 83.31% | 82.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.29% | 94.00% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.01% | 90.71% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.92% | 96.25% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.66% | 91.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.61% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.45% | 96.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.39% | 97.56% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.24% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584289 |
| LOTUS | LTS0121419 |
| wikiData | Q77310115 |