N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide
| Internal ID | 3a898d20-61d6-40c5-93da-1c908eb77f8c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > Acetamides |
| IUPAC Name | N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H27NO2/c1-4-5-6-7-8-9-10-11-14(17)12(2)15-13(3)16/h6-7,12,14,17H,4-5,8-11H2,1-3H3,(H,15,16)/b7-6-/t12-,14+/m1/s1 |
| InChI Key | YNBJXCBPPYCLMH-XBWLEZLWSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.204179104 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-z2r3s-3-hydroxydodec-8-en-2-ylacetamide.jpg "2D Structure of N-[(Z,2R,3S)-3-hydroxydodec-8-en-2-yl]acetamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.70% | 97.21% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.38% | 96.47% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.31% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.74% | 93.56% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.56% | 97.29% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.53% | 95.71% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.07% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.29% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.09% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.08% | 83.82% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.61% | 94.73% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.45% | 94.33% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 85.39% | 95.93% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.05% | 100.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.68% | 95.58% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.79% | 95.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.72% | 89.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.30% | 96.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.26% | 92.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.18% | 91.11% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.77% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.38% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46905981 |
| LOTUS | LTS0181920 |
| wikiData | Q105350872 |