N-Norcodeine
| Internal ID | f71e97fd-91fa-4720-9013-367740e55774 |
| Taxonomy | Alkaloids and derivatives > Morphinans |
| IUPAC Name | 9-methoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES (Canonical) | COC1=C2C3=C(CC4C5C3(CCN4)C(O2)C(C=C5)O)C=C1 |
| SMILES (Isomeric) | COC1=C2C3=C(CC4C5C3(CCN4)C(O2)C(C=C5)O)C=C1 |
| InChI | InChI=1S/C17H19NO3/c1-20-13-5-2-9-8-11-10-3-4-12(19)16-17(10,6-7-18-11)14(9)15(13)21-16/h2-5,10-12,16,18-19H,6-8H2,1H3 |
| InChI Key | HKOIXWVRNLGFOR-UHFFFAOYSA-N |
| Popularity | 31 references in papers |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 50.70 Ų |
| XlogP | 0.70 |
| Morphinan-6-ol, 7,8-didehydro-4,5-epoxy-3-methoxy-, (5.alpha.,6.alpha.)- |
| SCHEMBL120271 |
| DTXSID80859376 |
| HKOIXWVRNLGFOR-UHFFFAOYSA-N |
| 3-methoxy-7,8-didehydro-4,5-epoxymorphinan-6-ol |
| 7,8-Didehydro-4,5-.alpha.-epoxy-3-methoxymorphinan-6-.alpha.-ol |
| Morphinan-6.alpha.-ol, 7,8-didehydro-4,5.alpha.-epoxy-3-methoxy- |
| (5.alpha.,6.alpha.)-7,8-Didehydro-4,5-epoxy-3-methoxymorphinan-6-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
79.4 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.69% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.57% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.66% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.42% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.48% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.22% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.32% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.56% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.93% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.90% | 97.14% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.87% | 96.39% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.00% | 89.05% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.78% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Papaver somniferum |
| PubChem | 1255 |
| LOTUS | LTS0063807 |
| wikiData | Q105029829 |