N'-Nitrosoanabasine
Internal ID | b023fca2-c04f-44ab-a643-eab804905858 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | 3-(1-nitrosopiperidin-2-yl)pyridine |
SMILES (Canonical) | C1CCN(C(C1)C2=CN=CC=C2)N=O |
SMILES (Isomeric) | C1CCN(C(C1)C2=CN=CC=C2)N=O |
InChI | InChI=1S/C10H13N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h3-4,6,8,10H,1-2,5,7H2 |
InChI Key | BXYPVKMROLGXJI-UHFFFAOYSA-N |
Popularity | 63 references in papers |
Molecular Formula | C10H13N3O |
Molecular Weight | 191.23 g/mol |
Exact Mass | 191.105862047 g/mol |
Topological Polar Surface Area (TPSA) | 45.60 Ų |
XlogP | 1.50 |
N'-Nitrosoanabasine |
3-(1-nitrosopiperidin-2-yl)pyridine |
1-Nitroso-2-(3-pyridyl)piperidine |
N-NITROSOANABASINE |
Nitrosoanabasine |
3-(1-Nitroso-2-piperidinyl)pyridine |
(R,s)-n-nitrosoanabasine |
(R,S)-N-Nitroso Anabasine |
Y7VU5E9XAT |
Piperidine, 1-nitroso-2-(3-pyridyl)- |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.76% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.54% | 98.95% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.14% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.64% | 97.09% |
CHEMBL1075145 | P55072 | Transitional endoplasmic reticulum ATPase | 86.33% | 98.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.55% | 94.45% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.93% | 91.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.20% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.75% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 82.35% | 98.75% |
CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 82.34% | 94.55% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.51% | 86.33% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.72% | 98.33% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.08% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 14335 |
LOTUS | LTS0187864 |
wikiData | Q27156016 |