N-Methyllindcarpine
| Internal ID | b026af43-ee4d-49b3-b668-f4ef3cc324b8 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,10-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)O |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)OC)O |
| InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-13(21)19(24-3)17-15(11)12(20)8-10-4-5-14(23-2)18(22)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3 |
| InChI Key | MBKKEBKZSKSAPX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 62.20 Ų |
| XlogP | 2.20 |
| 6aalpha-Aporphine-2,11-diol, 1,10-dimethoxy-; (+)-2,11-Dihydroxy-1,10-dimethoxyaporphine |
| SCHEMBL8499138 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.93% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 98.13% | 95.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.83% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.44% | 91.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.88% | 93.99% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 93.73% | 96.76% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.85% | 91.79% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.70% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.41% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.15% | 93.40% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.02% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.47% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.40% | 91.03% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.63% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.11% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.67% | 85.14% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 85.59% | 98.44% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.53% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.22% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.00% | 94.45% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.60% | 95.78% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.69% | 92.94% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.65% | 99.15% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 80.14% | 95.70% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.12% | 96.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actinodaphne pruinosa |
| Artabotrys suaveolens |
| Glaucium fimbrilligerum |
| Phoebe clemensii |
| PubChem | 20556269 |
| LOTUS | LTS0189270 |
| wikiData | Q105160821 |