N-Methyldioncophyllin a
| Internal ID | 1573053b-374e-45f6-a1db-841544f85082 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
| IUPAC Name | 7-(4,5-dimethoxy-2-methylnaphthalen-1-yl)-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
| SMILES (Canonical) | CC1CC2=C(C(N1C)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)OC)O |
| SMILES (Isomeric) | CC1CC2=C(C(N1C)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)OC)O |
| InChI | InChI=1S/C25H29NO3/c1-14-12-21(29-6)24-18(8-7-9-20(24)28-5)22(14)19-11-10-17-13-15(2)26(4)16(3)23(17)25(19)27/h7-12,15-16,27H,13H2,1-6H3 |
| InChI Key | ZSYADESMHZOJRK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.21474379 g/mol |
| Topological Polar Surface Area (TPSA) | 41.90 Ų |
| XlogP | 5.50 |
| ZSYADESMHZOJRK-UHFFFAOYSA-N |
| 7-(4,5-Dimethoxy-2-methyl-1-naphthyl)-1,2,3-trimethyl-1,2,3,4-tetrahydro-8-isoquinolinol # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.97% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 96.23% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.81% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.74% | 91.49% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.48% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.94% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.72% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.72% | 95.89% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.55% | 95.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.83% | 93.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.51% | 89.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 90.37% | 97.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.05% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.35% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.27% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.89% | 99.15% |
| CHEMBL2337 | P48067 | Glycine transporter 1 | 85.95% | 95.45% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.72% | 89.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.66% | 94.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 85.16% | 91.79% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.01% | 91.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.25% | 93.56% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.95% | 100.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.92% | 100.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.97% | 94.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.62% | 96.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.41% | 92.62% |
| CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 82.35% | 89.76% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.52% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.85% | 97.14% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.27% | 93.18% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.12% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ancistrocladus abbreviatus |
| Dioncophyllum thollonii |
| Habropetalum dawei |
| PubChem | 633164 |
| LOTUS | LTS0232649 |
| wikiData | Q104389803 |