N-methyl-N-[1-oxo-1-[(2-oxopiperidin-3-yl)amino]-3-phenylpropan-2-yl]dec-9-enamide
| Internal ID | 14121692-18d1-4836-9634-8e83b5da6df5 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines > Amphetamines and derivatives |
| IUPAC Name | N-methyl-N-[1-oxo-1-[(2-oxopiperidin-3-yl)amino]-3-phenylpropan-2-yl]dec-9-enamide |
| SMILES (Canonical) | CN(C(CC1=CC=CC=C1)C(=O)NC2CCCNC2=O)C(=O)CCCCCCCC=C |
| SMILES (Isomeric) | CN(C(CC1=CC=CC=C1)C(=O)NC2CCCNC2=O)C(=O)CCCCCCCC=C |
| InChI | InChI=1S/C25H37N3O3/c1-3-4-5-6-7-8-12-17-23(29)28(2)22(19-20-14-10-9-11-15-20)25(31)27-21-16-13-18-26-24(21)30/h3,9-11,14-15,21-22H,1,4-8,12-13,16-19H2,2H3,(H,26,30)(H,27,31) |
| InChI Key | KBRMYAFKZQPUNJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.28349205 g/mol |
| Topological Polar Surface Area (TPSA) | 78.50 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.63% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.72% | 99.17% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.76% | 93.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.92% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.74% | 91.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.15% | 97.64% |
| CHEMBL4072 | P07858 | Cathepsin B | 88.06% | 93.67% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 87.99% | 98.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.79% | 90.08% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.74% | 89.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.50% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.95% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.17% | 90.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.08% | 92.97% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 83.13% | 98.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.70% | 93.99% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.50% | 95.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.04% | 96.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.86% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.68% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.35% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.43% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74333951 |
| LOTUS | LTS0131577 |
| wikiData | Q105138492 |