N-methyl-2-phenoxyquinolin-4(1h)-one
| Internal ID | e55000df-736b-45cd-a247-720db567b7e7 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 1-methyl-2-phenoxyquinolin-4-one |
| SMILES (Canonical) | CN1C2=CC=CC=C2C(=O)C=C1OC3=CC=CC=C3 |
| SMILES (Isomeric) | CN1C2=CC=CC=C2C(=O)C=C1OC3=CC=CC=C3 |
| InChI | InChI=1S/C16H13NO2/c1-17-14-10-6-5-9-13(14)15(18)11-16(17)19-12-7-3-2-4-8-12/h2-11H,1H3 |
| InChI Key | HBIGNUYKQYQFSC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.50% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.17% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.48% | 86.33% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 91.40% | 92.67% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.08% | 93.99% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 87.97% | 100.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.38% | 96.47% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.21% | 94.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.40% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.95% | 96.09% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.76% | 94.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.43% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.25% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Raputiarana heptaphylla |
| PubChem | 53348958 |
| LOTUS | LTS0215987 |
| wikiData | Q105025312 |