N-isobutyl-decanamide
| Internal ID | b61b1689-1e49-4064-bea0-299de33348df |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-(2-methylpropyl)decanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H29NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h13H,4-12H2,1-3H3,(H,15,16) |
| InChI Key | JIOJLCAPGHFHDI-UHFFFAOYSA-N |
| Popularity | 26 references in papers |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.224914549 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.90 |
| N-(2-methylpropyl)decanamide |
| n-isobutyldecanamide |
| 73785-31-6 |
| N-Isobutyl N-decanamide |
| ME6A5M9U1B |
| Decanamide, N-(2-methylpropyl)- |
| N-isobutyl-decanamide |
| starbld0048742 |
| TETRAHYDROPELLITORINE |
| UNII-ME6A5M9U1B |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.98% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.83% | 97.29% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.63% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.11% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.09% | 96.09% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.43% | 85.94% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.38% | 95.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.42% | 92.86% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 89.56% | 87.45% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.89% | 98.03% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.19% | 97.79% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.70% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.62% | 97.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.31% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.16% | 90.71% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.01% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.53% | 89.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.04% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.91% | 92.08% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.11% | 92.29% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.68% | 94.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.22% | 96.95% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.57% | 82.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.27% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cissampelos glaberrima |
| Piper tuberculatum |
| PubChem | 3613503 |
| LOTUS | LTS0073455 |
| wikiData | Q27893473 |