N-hydroxy-MeIQx
| Internal ID | ef115fc5-a812-47aa-980d-a55d41e16479 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines |
| IUPAC Name | N-(3,8-dimethylimidazo[4,5-f]quinoxalin-2-yl)hydroxylamine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H11N5O/c1-6-5-12-7-3-4-8-10(9(7)13-6)14-11(15-17)16(8)2/h3-5,17H,1-2H3,(H,14,15) |
| InChI Key | FVNCCTJGBOTWTM-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09635999 g/mol |
| Topological Polar Surface Area (TPSA) | 75.90 Ų |
| XlogP | 1.20 |
| 115044-41-2 |
| N-Hydroxy-methyl-IQX |
| 2-Hydroxyamino-3,8-dimethylimidazo[4,5-f]quinoxaline |
| N-(3,8-Dimethyl-3H-imidazo[4,5-f]quinoxalin-2-yl)hydroxylamine |
| 3,8-Dimethyl-1,3-dihydro-2H-imidazo(4,5-f)quinoxalin-2-one oxime |
| JK23F1137Z |
| 2H-Imidazo(4,5-f)quinoxalin-2-one, 1,3-dihydro-3,8-dimethyl-, oxime |
| N-(3,8-dimethylimidazo[4,5-f]quinoxalin-2-yl)hydroxylamine |
| 2-Hydroxyamino-3,8-dimethylimidazo(4,5-f)quinoxaline |
| CCRIS 3363 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.21% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.12% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.78% | 94.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.45% | 93.10% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.16% | 90.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.11% | 97.53% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.38% | 91.49% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.99% | 97.36% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.62% | 94.00% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 87.48% | 95.39% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.41% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.33% | 86.33% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.04% | 85.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.69% | 96.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.60% | 92.97% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.43% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.92% | 95.56% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.02% | 97.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.68% | 98.95% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.15% | 89.44% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.14% | 89.67% |
| CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 80.60% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 115104 |
| LOTUS | LTS0072289 |
| wikiData | Q105105622 |