N-hydroxy-L-arginine (NOHA)
| Internal ID | 67d62703-684d-4dfd-9828-00c38417956d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > N-hydroxyl-alpha-amino acids |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(hydroxyamino)pentanoic acid |
| SMILES (Canonical) | C(CC(C(=O)O)NO)CN=C(N)N |
| SMILES (Isomeric) | C(C[C@@H](C(=O)O)NO)CN=C(N)N |
| InChI | InChI=1S/C6H14N4O3/c7-6(8)9-3-1-2-4(10-13)5(11)12/h4,10,13H,1-3H2,(H,11,12)(H4,7,8,9)/t4-/m0/s1 |
| InChI Key | WQFIAVZQVYASHZ-BYPYZUCNSA-N |
| Popularity | 213 references in papers |
| Molecular Formula | C6H14N4O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10659032 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | -4.20 |
| N-hydroxy-L-arginine (NOHA) |
| BDBM130379 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.77% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.50% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.87% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.97% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.55% | 96.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.33% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.76% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.82% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.69% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.67% | 94.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.11% | 97.29% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.81% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.98% | 90.20% |
| CHEMBL204 | P00734 | Thrombin | 81.91% | 96.01% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.60% | 92.29% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.44% | 95.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.23% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cycas revoluta |
| PubChem | 9836994 |
| LOTUS | LTS0106777 |
| wikiData | Q105310688 |