N-(gamma-L-glutamyl)-L-alaninol
| Internal ID | e5191535-4472-4a9c-8e17-118b3e6faadf |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamine and derivatives |
| IUPAC Name | (2S)-2-amino-5-[[(2S)-1-hydroxypropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H16N2O4/c1-5(4-11)10-7(12)3-2-6(9)8(13)14/h5-6,11H,2-4,9H2,1H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
| InChI Key | JJWXGBABENFUNJ-WDSKDSINSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11100700 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -4.00 |
| N-(gamma-L-glutamyl)-L-alaninol |
| CHEBI:85894 |
| N-[(2S)-1-hydroxypropan-2-yl]-L-glutamine |
| Q27158565 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.36% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.16% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 93.04% | 92.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.83% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.71% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.67% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.64% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.55% | 96.47% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.98% | 97.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.33% | 90.20% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.77% | 91.19% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.48% | 93.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.34% | 89.63% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.32% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.82% | 94.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.66% | 89.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.94% | 94.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.57% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25202986 |
| LOTUS | LTS0219892 |
| wikiData | Q27158565 |