N-formyl-1H-pyrrole-2-carboxamide
| Internal ID | 22cfb2c2-8335-4fcd-9946-4c9cda4adb1f |
| Taxonomy | Organoheterocyclic compounds > Pyrroles > Pyrrole carboxylic acids and derivatives > Pyrrole carboxamides |
| IUPAC Name | N-formyl-1H-pyrrole-2-carboxamide |
| SMILES (Canonical) | C1=CNC(=C1)C(=O)NC=O |
| SMILES (Isomeric) | C1=CNC(=C1)C(=O)NC=O |
| InChI | InChI=1S/C6H6N2O2/c9-4-8-6(10)5-2-1-3-7-5/h1-4,7H,(H,8,9,10) |
| InChI Key | MDJAUADLFBYWQT-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.042927438 g/mol |
| Topological Polar Surface Area (TPSA) | 62.00 Ų |
| XlogP | 0.40 |
| 160156-23-0 |
| 1H-Pyrrole-2-carboxamide,N-formyl-(9CI) |
| N-formylpyrrole-2-carboxamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.09% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.12% | 94.45% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.79% | 87.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.64% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.85% | 96.09% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.48% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21773255 |
| LOTUS | LTS0083447 |
| wikiData | Q105161788 |