n-Feruloyl-3-methoxytyramine
Internal ID | e3199fbb-9ec3-421d-ab89-5bbbfda431e0 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide |
SMILES (Canonical) | COC1=C(C=CC(=C1)CCNC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CCNC(=O)C=CC2=CC(=C(C=C2)O)OC)O |
InChI | InChI=1S/C19H21NO5/c1-24-17-11-13(3-6-15(17)21)5-8-19(23)20-10-9-14-4-7-16(22)18(12-14)25-2/h3-8,11-12,21-22H,9-10H2,1-2H3,(H,20,23) |
InChI Key | GRXBVKANHNUZNL-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H21NO5 |
Molecular Weight | 343.40 g/mol |
Exact Mass | 343.14197277 g/mol |
Topological Polar Surface Area (TPSA) | 88.00 Ų |
XlogP | 2.10 |
3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide |
N-trans-Feruloylmethoxytyramine; trans-Feruloylmethoxytyramine; trans-N-Feruloyl-3-O-methyldopamine |
SCHEMBL1842826 |
AKOS032962215 |
B0005-151667 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.30% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.16% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.09% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.84% | 96.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 89.40% | 90.20% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.23% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 88.10% | 98.75% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.74% | 89.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.64% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.28% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.88% | 95.56% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.81% | 96.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.52% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 83.20% | 90.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.97% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 134313 |
LOTUS | LTS0159666 |
wikiData | Q105016799 |