2-(Carbamoylamino)Pentanedioic Acid
| Internal ID | 34f3749e-e6ab-4731-8f43-ed8b2910405e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamic acid and derivatives |
| IUPAC Name | 2-(carbamoylamino)pentanedioic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13) |
| InChI Key | LCQLHJZYVOQKHU-UHFFFAOYSA-N |
| Popularity | 116 references in papers |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05897142 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | -2.40 |
| RefChem:1061513 |
| N-carbamoylglutamic acid |
| 40860-26-2 |
| 2-ureidopentanedioic acid |
| 2-[(aminocarbonyl)amino]pentanedioic acid |
| N-Cbm-Glu-OH |
| n-carbamoylglutamate |
| NCGC00167549-01 |
| 2-ureidopentanedioicacid |
| bmse000376 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.35% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.43% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.34% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.74% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.65% | 90.20% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.32% | 98.95% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.01% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.15% | 93.56% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 84.79% | 92.26% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.39% | 91.19% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.59% | 92.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.40% | 91.11% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.25% | 96.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3679006 |
| LOTUS | LTS0190662 |
| wikiData | Q27159095 |