N-Butylbenzamide
| Internal ID | 23e7eb3c-b1bf-4992-89ae-ef825cc15077 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-butylbenzamide |
| SMILES (Canonical) | CCCCNC(=O)C1=CC=CC=C1 |
| SMILES (Isomeric) | CCCCNC(=O)C1=CC=CC=C1 |
| InChI | InChI=1S/C11H15NO/c1-2-3-9-12-11(13)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,12,13) |
| InChI Key | BAULSHLTGVOYKM-UHFFFAOYSA-N |
| Popularity | 36 references in papers |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.115364102 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 2.10 |
| 2782-40-3 |
| Benzamide, N-butyl- |
| Butylbenzamide |
| N-n-Butylbenzamide |
| EINECS 220-485-4 |
| NSC 26916 |
| BRN 2045962 |
| AI3-00818 |
| N-butyl-benzamide |
| NSC26916 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.92% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.41% | 90.17% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.92% | 87.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.09% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.74% | 96.09% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 87.44% | 81.11% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.24% | 96.67% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.40% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.86% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.68% | 94.73% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.52% | 89.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.13% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.11% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 80.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhaphidophora decursiva |
| PubChem | 76024 |
| LOTUS | LTS0000649 |
| wikiData | Q83052799 |