N-Benzyl-N'-(4-methoxybenzyl)urea
Internal ID | dc3f9e00-0626-4799-97e4-9ec5b3c7a0c2 |
Taxonomy | Benzenoids > Phenol ethers > Anisoles |
IUPAC Name | 1-benzyl-3-[(4-methoxyphenyl)methyl]urea |
SMILES (Canonical) | COC1=CC=C(C=C1)CNC(=O)NCC2=CC=CC=C2 |
SMILES (Isomeric) | COC1=CC=C(C=C1)CNC(=O)NCC2=CC=CC=C2 |
InChI | InChI=1S/C16H18N2O2/c1-20-15-9-7-14(8-10-15)12-18-16(19)17-11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H2,17,18,19) |
InChI Key | ZTKPCNPGXYPVPM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H18N2O2 |
Molecular Weight | 270.33 g/mol |
Exact Mass | 270.136827821 g/mol |
Topological Polar Surface Area (TPSA) | 50.40 Ų |
XlogP | 2.30 |
ZTKPCNPGXYPVPM-UHFFFAOYSA-N |
1-Benzyl-3-(4-methoxybenzyl)urea |
N-Benzyl-N'-(4-methoxybenzyl)urea |
1-benzyl-3-[(4-methoxyphenyl)methyl]urea |
EN300-7501655 |
Urea, N-[(4-methoxyphenyl)methyl]-N'-(phenylmethyl)- |
Z123923406 |
188911-54-8 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.44% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.10% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.99% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 94.97% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.51% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.90% | 90.00% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.41% | 92.67% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.80% | 93.81% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.58% | 99.17% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.33% | 90.24% |
CHEMBL2535 | P11166 | Glucose transporter | 82.50% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.43% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.88% | 94.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.75% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pentadiplandra brazzeana |
PubChem | 15323520 |
LOTUS | LTS0213654 |
wikiData | Q105382994 |