N-Benzyl-(9Z,12Z,15Z)-octadecatrienamide
| Internal ID | 6f7e5ae8-f5a4-4ab7-b2b4-54fe0846c6a4 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide |
| SMILES (Canonical) | CCC=CCC=CCC=CCCCCCCCC(=O)NCC1=CC=CC=C1 |
| SMILES (Isomeric) | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCC1=CC=CC=C1 |
| InChI | InChI=1S/C25H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h3-4,6-7,9-10,16-18,20-21H,2,5,8,11-15,19,22-23H2,1H3,(H,26,27)/b4-3-,7-6-,10-9- |
| InChI Key | VCMMYRWIEZCYDK-PDBXOOCHSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.287514804 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 7.10 |
| 883715-18-2 |
| n-benzyl-(9z,12z,15z)-octadecatrienamide |
| N-benzyl-9Z,12Z,15Z-octadecatrienamide |
| N-?Benzyllinolenamide |
| UNII-60D4QDV5QG |
| (9Z,12Z,15Z)-N-benzyloctadeca-9,12,15-trienamide |
| 60D4QDV5QG |
| CHEMBL2413161 |
| 9,12,15-Octadecatrienamide, N-(phenylmethyl)-, (9Z,12Z,15Z)- |
| N-(9Z,12Z,15Z-octadecatrienoyl) benzylamine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.04% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.98% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.79% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.12% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.89% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.28% | 95.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 90.29% | 93.81% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 89.48% | 97.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.61% | 95.50% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 86.09% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.36% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.79% | 92.08% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.46% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Heliopsis helianthoides |
| Lepidium meyenii |
| PubChem | 68741582 |
| LOTUS | LTS0115495 |
| wikiData | Q27263220 |