N-benzyl-9-oxooctadeca-12,15-dienamide
| Internal ID | 1a7310bb-081c-48ad-939d-e435b8768ba2 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-benzyl-9-oxooctadeca-12,15-dienamide |
| SMILES (Canonical) | CCC=CCC=CCCC(=O)CCCCCCCC(=O)NCC1=CC=CC=C1 |
| SMILES (Isomeric) | CCC=CCC=CCCC(=O)CCCCCCCC(=O)NCC1=CC=CC=C1 |
| InChI | InChI=1S/C25H37NO2/c1-2-3-4-5-6-8-14-19-24(27)20-15-9-7-10-16-21-25(28)26-22-23-17-12-11-13-18-23/h3-4,6,8,11-13,17-18H,2,5,7,9-10,14-16,19-22H2,1H3,(H,26,28) |
| InChI Key | OKPZGMGCJRBZIN-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.60 g/mol |
| Exact Mass | 383.282429423 g/mol |
| Topological Polar Surface Area (TPSA) | 46.20 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.74% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.26% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.05% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.99% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.14% | 95.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 89.72% | 93.81% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.06% | 95.50% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.33% | 97.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.36% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.48% | 92.08% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.83% | 90.24% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.21% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lepidium meyenii |
| PubChem | 73804199 |
| LOTUS | LTS0159519 |
| wikiData | Q105193680 |