N-((1S,2R)-2-Hydroxy-1-(hydroxymethyl)heptadecyl)acetamide
| Internal ID | 58f54828-35de-4ecb-bb26-2195097f0cd5 |
| Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Ceramides |
| IUPAC Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h19-20,22,24H,3-17H2,1-2H3,(H,21,23)/t19-,20+/m0/s1 |
| InChI Key | CRJGESKKUOMBCT-VQTJNVASSA-N |
| Popularity | 34 references in papers |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.30864417 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 6.10 |
| N-acetylsphinganine |
| 13031-64-6 |
| C2-dihydroceramide |
| N-Acetyl dihydrosphingosine |
| N-acetyldihydrosphingosine |
| N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide |
| D-erythro-N-Acetylsphinganine |
| dS-N-Acetylsphinganine |
| dihydro-C2-ceramide |
| TIC-016 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.30% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.73% | 97.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.61% | 92.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.18% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.91% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.79% | 83.82% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.43% | 93.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.79% | 98.03% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 87.39% | 95.93% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.08% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.86% | 91.81% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.31% | 100.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.59% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.53% | 91.11% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.51% | 91.24% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.36% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.86% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.18% | 92.29% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.96% | 94.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.94% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.70% | 97.21% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.97% | 85.94% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.89% | 87.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.75% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.28% | 94.73% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.19% | 98.75% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.68% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6610273 |
| LOTUS | LTS0023784 |
| wikiData | Q27133532 |