N-Acetylindoxyl
| Internal ID | 9e63223e-593c-4d89-8cde-c25fe40b0604 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Hydroxyindoles |
| IUPAC Name | 1-(3-hydroxyindol-1-yl)ethanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H9NO2/c1-7(12)11-6-10(13)8-4-2-3-5-9(8)11/h2-6,13H,1H3 |
| InChI Key | NNJXIAOPPYUVAX-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.063328530 g/mol |
| Topological Polar Surface Area (TPSA) | 42.20 Ų |
| XlogP | 1.50 |
| 33025-60-4 |
| N-Acetylindoxyl |
| 1-(3-Hydroxy-1H-indol-1-yl)ethanone |
| 1-ACETYL-3-HYDROXYINDOLE |
| 1-(3-hydroxyindol-1-yl)ethanone |
| Acetylindoxyl |
| 1H-Indol-3-ol, 1-acetyl- |
| 1-acetyl-1H-indol-3-ol |
| 1-(3-hydroxy-1H-indol-1-yl)ethan-1-one |
| C02298 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.31% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.84% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.97% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.42% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.74% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.87% | 99.23% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 83.87% | 100.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.10% | 93.65% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.48% | 94.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.39% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 439701 |
| LOTUS | LTS0075908 |
| wikiData | Q27089400 |