N-[(7S)-2,3-dihydroxy-1,10-dimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide
Internal ID | 668fb884-13d2-4124-8619-04a79ef6f859 |
Taxonomy | Hydrocarbon derivatives > Tropones |
IUPAC Name | N-[(7S)-2,3-dihydroxy-1,10-dimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
SMILES (Canonical) | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)O)O |
SMILES (Isomeric) | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)O)O |
InChI | InChI=1S/C20H21NO6/c1-10(22)21-14-6-4-11-8-16(24)19(25)20(27-3)18(11)12-5-7-17(26-2)15(23)9-13(12)14/h5,7-9,14,24-25H,4,6H2,1-3H3,(H,21,22)/t14-/m0/s1 |
InChI Key | DEIXKZGDCOFYAR-AWEZNQCLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H21NO6 |
Molecular Weight | 371.40 g/mol |
Exact Mass | 371.13688739 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 0.20 |
SCHEMBL2146741 |
![2D Structure of N-[(7S)-2,3-dihydroxy-1,10-dimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide 2D Structure of N-[(7S)-2,3-dihydroxy-1,10-dimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-7s-23-dihydroxy-110-dimethoxy-9-oxo-67-dihydro-5h-benzoaheptalen-7-ylacetamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.87% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.53% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.96% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 93.66% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.99% | 90.71% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.35% | 91.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 90.95% | 95.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.37% | 99.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.89% | 96.38% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.60% | 91.19% |
CHEMBL2535 | P11166 | Glucose transporter | 88.50% | 98.75% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.42% | 93.03% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.87% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.90% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.69% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.68% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.69% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.59% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.55% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.41% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.05% | 96.21% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.30% | 95.64% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.72% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.46% | 86.33% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.86% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Colchicum bivonae |
PubChem | 21141161 |
LOTUS | LTS0059161 |
wikiData | Q104977277 |