N-(6-acetamidopyridin-3-yl)acetamide
| Internal ID | 36ca0bd7-c43f-45ea-a7a6-24a578de687a |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > N-arylamides > N-acetylarylamines |
| IUPAC Name | N-(6-acetamidopyridin-3-yl)acetamide |
| SMILES (Canonical) | CC(=O)NC1=CN=C(C=C1)NC(=O)C |
| SMILES (Isomeric) | CC(=O)NC1=CN=C(C=C1)NC(=O)C |
| InChI | InChI=1S/C9H11N3O2/c1-6(13)11-8-3-4-9(10-5-8)12-7(2)14/h3-5H,1-2H3,(H,11,13)(H,10,12,14) |
| InChI Key | RITVBFZKAMDJHU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.085126602 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 93.18% | 81.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.33% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.10% | 96.09% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.12% | 94.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.39% | 94.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.37% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.50% | 98.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.28% | 97.21% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.05% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 130005129 |
| LOTUS | LTS0099977 |
| wikiData | Q105237132 |