N-(4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)formamide
| Internal ID | 6586ff38-8717-4ca8-9475-f6e1ad36bb8f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| IUPAC Name | N-(4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)formamide |
| SMILES (Canonical) | CC(C)C1CCC2(CCCC(=C)C2C1NC=O)C |
| SMILES (Isomeric) | CC(C)C1CCC2(CCCC(=C)C2C1NC=O)C |
| InChI | InChI=1S/C16H27NO/c1-11(2)13-7-9-16(4)8-5-6-12(3)14(16)15(13)17-10-18/h10-11,13-15H,3,5-9H2,1-2,4H3,(H,17,18) |
| InChI Key | URMSVRXRZNJMON-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.209264485 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.59% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.44% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.51% | 95.56% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.54% | 96.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.47% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.61% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.98% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.55% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.37% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 85.02% | 85.30% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.67% | 96.47% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.32% | 93.67% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.02% | 91.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.50% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.23% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.55% | 95.89% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 81.40% | 81.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.60% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.11% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13892674 |
| LOTUS | LTS0161047 |
| wikiData | Q105277860 |