N-[(4-hydroxy-3-methoxyphenyl)methyl]-9-methyldec-6-enamide
Internal ID | 8571b7e1-89e0-41dc-8a93-e800f6a73b5d |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-9-methyldec-6-enamide |
SMILES (Canonical) | CC(C)CC=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CC(C)CC=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C19H29NO3/c1-15(2)9-7-5-4-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h5,7,11-13,15,21H,4,6,8-10,14H2,1-3H3,(H,20,22) |
InChI Key | JZNZUOZRIWOBGG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H29NO3 |
Molecular Weight | 319.40 g/mol |
Exact Mass | 319.21474379 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of N-[(4-hydroxy-3-methoxyphenyl)methyl]-9-methyldec-6-enamide 2D Structure of N-[(4-hydroxy-3-methoxyphenyl)methyl]-9-methyldec-6-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-4-hydroxy-3-methoxyphenylmethyl-9-methyldec-6-enamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.50% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.08% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.97% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.98% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 95.39% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.82% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 93.84% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.74% | 95.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.73% | 97.29% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.91% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.84% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.23% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.76% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.98% | 90.71% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.28% | 96.67% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.04% | 96.25% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 83.51% | 85.31% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.37% | 92.88% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.82% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.63% | 94.73% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.11% | 89.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.94% | 97.21% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.89% | 100.00% |
CHEMBL3891 | P07384 | Calpain 1 | 80.23% | 93.04% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.14% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Viburnum luzonicum |
PubChem | 78070862 |
LOTUS | LTS0072128 |
wikiData | Q105219044 |