N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide
Internal ID | 6d323372-414b-45c9-b6e1-5434a3860198 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide |
SMILES (Canonical) | CC(C)C=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CC(C)C=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21) |
InChI Key | YKPUWZUDDOIDPM-UHFFFAOYSA-N |
Popularity | 5,433 references in papers |
Molecular Formula | C18H27NO3 |
Molecular Weight | 305.40 g/mol |
Exact Mass | 305.19909372 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 3.60 |
Atomic LogP (AlogP) | 3.79 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 9 |
N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide |
8-Methyl-N-Vanillyl-6-Nonenamide |
Zucapsaicin;Civamide;cis-Capsaicin |
MFCD00209942 |
BRN 4261852 |
Spectrum_000303 |
Prestwick0_000879 |
Prestwick1_000879 |
Spectrum2_000770 |
Spectrum3_001449 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide 2D Structure of N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-4-hydroxy-3-methoxyphenylmethyl-8-methyl-6-nonenamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9906 | 99.06% |
Caco-2 | - | 0.6205 | 62.05% |
Blood Brain Barrier | + | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Mitochondria | 0.9272 | 92.72% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8679 | 86.79% |
OATP1B3 inhibitior | + | 0.9404 | 94.04% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | + | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.8872 | 88.72% |
P-glycoprotein inhibitior | - | 0.8841 | 88.41% |
P-glycoprotein substrate | - | 0.7628 | 76.28% |
CYP3A4 substrate | + | 0.5094 | 50.94% |
CYP2C9 substrate | + | 0.6153 | 61.53% |
CYP2D6 substrate | - | 0.7925 | 79.25% |
CYP3A4 inhibition | + | 0.8287 | 82.87% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | + | 0.6667 | 66.67% |
CYP inhibitory promiscuity | - | 0.7551 | 75.51% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8071 | 80.71% |
Carcinogenicity (trinary) | Non-required | 0.6924 | 69.24% |
Eye corrosion | - | 0.9885 | 98.85% |
Eye irritation | - | 0.5473 | 54.73% |
Skin irritation | + | 0.5683 | 56.83% |
Skin corrosion | - | 0.9425 | 94.25% |
Ames mutagenesis | - | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8643 | 86.43% |
Micronuclear | - | 0.5800 | 58.00% |
Hepatotoxicity | - | 0.9323 | 93.23% |
skin sensitisation | - | 0.8775 | 87.75% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.7889 | 78.89% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.8599 | 85.99% |
Acute Oral Toxicity (c) | III | 0.6676 | 66.76% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | - | 0.6803 | 68.03% |
Thyroid receptor binding | + | 0.8461 | 84.61% |
Glucocorticoid receptor binding | - | 0.6040 | 60.40% |
Aromatase binding | - | 0.5481 | 54.81% |
PPAR gamma | + | 0.6998 | 69.98% |
Honey bee toxicity | - | 0.8898 | 88.98% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.6765 | 67.65% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4794 | Q8NER1 | Vanilloid receptor |
2.512 nM 28.2 nM |
EC50 EC50 |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.08% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.78% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 96.98% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.40% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.41% | 90.20% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.68% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.25% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.14% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.03% | 90.24% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.14% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.86% | 99.15% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.95% | 96.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.89% | 90.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.37% | 98.11% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.20% | 92.88% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.90% | 97.29% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.53% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.43% | 94.73% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.58% | 89.33% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.14% | 96.25% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.97% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.58% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Capsicum pubescens |
PubChem | 2548 |
LOTUS | LTS0014170 |
wikiData | Q27166370 |