N-[(4-hydroxy-3-methoxyphenyl)methyl]-6-methylhept-4-enamide
| Internal ID | c6759385-5541-41dd-8881-75c3fa10ea8d |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-6-methylhept-4-enamide |
| SMILES (Canonical) | CC(C)C=CCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| SMILES (Isomeric) | CC(C)C=CCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| InChI | InChI=1S/C16H23NO3/c1-12(2)6-4-5-7-16(19)17-11-13-8-9-14(18)15(10-13)20-3/h4,6,8-10,12,18H,5,7,11H2,1-3H3,(H,17,19) |
| InChI Key | UTTHCQMKBGTYNK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of N-[(4-hydroxy-3-methoxyphenyl)methyl]-6-methylhept-4-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-4-hydroxy-3-methoxyphenylmethyl-6-methylhept-4-enamide.jpg "2D Structure of N-[(4-hydroxy-3-methoxyphenyl)methyl]-6-methylhept-4-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.86% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.65% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 97.11% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.79% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.15% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.81% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.83% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.65% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.65% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.15% | 99.15% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.62% | 90.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.02% | 90.24% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.82% | 96.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.67% | 92.88% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.10% | 91.19% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.88% | 94.73% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.29% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| PubChem | 181309 |
| LOTUS | LTS0062067 |
| wikiData | Q105279076 |