N-(4-hydroxy-3-methoxybenzylidene)-2-(4-hydroxyphenyl)ethanamine
| Internal ID | 7186bb03-f21a-4acf-aa18-206ce62bf18e |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)ethyliminomethyl]-2-methoxyphenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H17NO3/c1-20-16-10-13(4-7-15(16)19)11-17-9-8-12-2-5-14(18)6-3-12/h2-7,10-11,18-19H,8-9H2,1H3 |
| InChI Key | VHUINYRVPRWTFR-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 62.10 Ų |
| XlogP | 2.90 |
| N-(4-hydroxy-3-methoxybenzylidene)-2-(4-hydroxyphenyl)ethanamine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.78% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.67% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.88% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.37% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.66% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.53% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 88.18% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.81% | 98.35% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.45% | 91.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.15% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.36% | 90.24% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.68% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.10% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.49% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.31% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crinum asiaticum |
| PubChem | 137185677 |
| LOTUS | LTS0155479 |
| wikiData | Q105286620 |