N-(4-benzamidobutyl)benzamide
| Internal ID | d8a05899-2737-4ff6-bf7b-f7f200519fbd |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-(4-benzamidobutyl)benzamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H20N2O2/c21-17(15-9-3-1-4-10-15)19-13-7-8-14-20-18(22)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,19,21)(H,20,22) |
| InChI Key | QSFWQDFBUPYPIH-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 58.20 Ų |
| XlogP | 2.50 |
| 31991-78-3 |
| N,N'-(butane-1,4-diyl)dibenzamide |
| NSC16587 |
| Dibenzoyltetramethylendiamin |
| SCHEMBL8779817 |
| DTXSID60953881 |
| MFCD00094674 |
| NSC-16587 |
| AKOS003885513 |
| F19830 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.59% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 92.10% | 81.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.02% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.68% | 90.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.80% | 96.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.03% | 91.11% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.89% | 89.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.76% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.17% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.46% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.27% | 96.09% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.09% | 93.81% |
| CHEMBL5028 | O14672 | ADAM10 | 80.50% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Uvaria littoralis |
| PubChem | 226276 |
| LOTUS | LTS0056994 |
| wikiData | Q82932812 |