N-(4-acetamido-3-hydroxybutyl)-2-hydroxy-4,8-dimethylundeca-3,6,8-trienamide
| Internal ID | 84156882-8d26-4f69-ba9c-c9eb95d15503 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-(4-acetamido-3-hydroxybutyl)-2-hydroxy-4,8-dimethylundeca-3,6,8-trienamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H32N2O4/c1-5-7-14(2)8-6-9-15(3)12-18(24)19(25)20-11-10-17(23)13-21-16(4)22/h6-8,12,17-18,23-24H,5,9-11,13H2,1-4H3,(H,20,25)(H,21,22) |
| InChI Key | LNMQCLOBYXKUCL-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23620751 g/mol |
| Topological Polar Surface Area (TPSA) | 98.70 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.20% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.46% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.90% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.48% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.09% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.13% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.88% | 96.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.73% | 89.34% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.98% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.93% | 93.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.24% | 85.14% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.04% | 98.59% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.30% | 100.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 82.25% | 80.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.03% | 97.21% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.51% | 89.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.28% | 94.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.12% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 91087674 |
| LOTUS | LTS0083136 |
| wikiData | Q104171129 |