N-[(3Z)-3-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide
| Internal ID | 6782cc6c-0d02-405f-8994-f2296d443927 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | N-[(3Z)-3-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H12BrN5O3/c12-5-1-7(14-3-5)9(19)15-4-6(18)2-8-10(20)17-11(13)16-8/h1-3,6,14,18H,4H2,(H,15,19)(H3,13,16,17,20)/b8-2- |
| InChI Key | DGOLYPALKIXHIE-WAPJZHGLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H12BrN5O3 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.01235 g/mol |
| Topological Polar Surface Area (TPSA) | 133.00 Ų |
| XlogP | -0.90 |
| There are no found synonyms. |
![2D Structure of N-[(3Z)-3-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-3z-3-2-amino-4-oxo-1h-imidazol-5-ylidene-2-hydroxypropyl-4-bromo-1h-pyrrole-2-carboxamide.jpg "2D Structure of N-[(3Z)-3-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.79% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.63% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.77% | 96.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.79% | 83.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.08% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.91% | 83.82% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 87.31% | 80.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.25% | 89.34% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.09% | 98.95% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 85.82% | 95.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.56% | 90.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.42% | 90.71% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 85.12% | 94.01% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.55% | 90.17% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 84.39% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.23% | 92.88% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.01% | 80.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.71% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.33% | 98.75% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.27% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10065940 |
| LOTUS | LTS0060700 |
| wikiData | Q104978944 |