N-(3-methylbutyl)octadeca-2,4,12-trienamide
| Internal ID | 70e7f09c-d4e0-4dc5-b665-034692526ae1 |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | N-(3-methylbutyl)octadeca-2,4,12-trienamide |
| SMILES (Canonical) | CCCCCC=CCCCCCCC=CC=CC(=O)NCCC(C)C |
| SMILES (Isomeric) | CCCCCC=CCCCCCCC=CC=CC(=O)NCCC(C)C |
| InChI | InChI=1S/C23H41NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)24-21-20-22(2)3/h8-9,16-19,22H,4-7,10-15,20-21H2,1-3H3,(H,24,25) |
| InChI Key | KEKYDAUAAYJDRA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 347.318814931 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 8.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.29% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.97% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.86% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.77% | 89.63% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.25% | 92.86% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.80% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.71% | 93.56% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.28% | 89.34% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.56% | 96.47% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.57% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.48% | 90.17% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.43% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.54% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.23% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.04% | 94.73% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.84% | 94.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.41% | 90.71% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.17% | 98.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.15% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.52% | 92.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.50% | 94.45% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.86% | 91.81% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.85% | 85.94% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.10% | 96.38% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.35% | 96.67% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.20% | 96.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.98% | 87.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.35% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| PubChem | 162920928 |
| LOTUS | LTS0199290 |
| wikiData | Q105140013 |