N-(3-Hydroxydecanoyl)serine
| Internal ID | d5037925-28bb-447d-9003-ff704f2bc888 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids |
| IUPAC Name | (2S)-3-hydroxy-2-[[(3R)-3-hydroxydecanoyl]amino]propanoic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CO)C(=O)O)O |
| SMILES (Isomeric) | CCCCCCC[C@H](CC(=O)N[C@@H](CO)C(=O)O)O |
| InChI | InChI=1S/C13H25NO5/c1-2-3-4-5-6-7-10(16)8-12(17)14-11(9-15)13(18)19/h10-11,15-16H,2-9H2,1H3,(H,14,17)(H,18,19)/t10-,11+/m1/s1 |
| InChI Key | NDDJIMSGSZNACM-MNOVXSKESA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17327290 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 1.20 |
| 541-81-1 |
| N-(3-Hydroxydecanoyl)serine |
| ((R)-3-hydroxydecanoyl)-L-serine |
| DTXSID80968972 |
| N-(1,3-Dihydroxydecylidene)serine |
| (2S)-3-hydroxy-2-[[(3R)-3-hydroxydecanoyl]amino]propanoic acid |
| AKOS040754010 |
| L-Serine, N-(3-hydroxy-1-oxodecyl)-, (R)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.69% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.70% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.46% | 97.29% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.73% | 92.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.13% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.81% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.55% | 100.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.64% | 96.00% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 87.32% | 95.93% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.25% | 91.81% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.53% | 90.20% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.09% | 92.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.92% | 96.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.16% | 92.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.46% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.14% | 83.82% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.95% | 89.63% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.92% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.70% | 96.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.52% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.68% | 96.47% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.15% | 97.21% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.67% | 96.90% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.30% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 193310 |
| LOTUS | LTS0079678 |
| wikiData | Q75059082 |