N-(3-hydroxy-11-methyldodecan-2-yl)acetamide
| Internal ID | 1c3ba5e2-1f1c-47ab-a139-a3f502b22e13 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > Acetamides |
| IUPAC Name | N-(3-hydroxy-11-methyldodecan-2-yl)acetamide |
| SMILES (Canonical) | CC(C)CCCCCCCC(C(C)NC(=O)C)O |
| SMILES (Isomeric) | CC(C)CCCCCCCC(C(C)NC(=O)C)O |
| InChI | InChI=1S/C15H31NO2/c1-12(2)10-8-6-5-7-9-11-15(18)13(3)16-14(4)17/h12-13,15,18H,5-11H2,1-4H3,(H,16,17) |
| InChI Key | PRFSPTJBPXYTAI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.235479232 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.81% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.31% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.82% | 97.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.49% | 97.21% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.38% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.77% | 93.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.57% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.03% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.40% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.14% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.32% | 94.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.99% | 94.33% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.61% | 87.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.32% | 95.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.17% | 90.71% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.07% | 98.05% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.04% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.31% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74928170 |
| LOTUS | LTS0233506 |
| wikiData | Q105213654 |