N-(3-(Aminomethyl)benzyl)acetamidine
Internal ID | 572238bd-817d-4acd-a802-e71bdff5ae3b |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylmethylamines |
IUPAC Name | N'-[[3-(aminomethyl)phenyl]methyl]ethanimidamide |
SMILES (Canonical) | CC(=NCC1=CC=CC(=C1)CN)N |
SMILES (Isomeric) | CC(=NCC1=CC=CC(=C1)CN)N |
InChI | InChI=1S/C10H15N3/c1-8(12)13-7-10-4-2-3-9(5-10)6-11/h2-5H,6-7,11H2,1H3,(H2,12,13) |
InChI Key | RODUKNYOEVZQPR-UHFFFAOYSA-N |
Popularity | 428 references in papers |
Molecular Formula | C10H15N3 |
Molecular Weight | 177.25 g/mol |
Exact Mass | 177.126597491 g/mol |
Topological Polar Surface Area (TPSA) | 64.40 Ų |
XlogP | -0.20 |
180001-34-7 |
N-(3-(AMINOMETHYL)BENZYL)ACETAMIDINE |
n-[3-(aminomethyl)benzyl]acetamidine |
W 1400 |
N-{[3-(aminomethyl)phenyl]methyl}ethanimidamide |
M1VB8VP8OH |
N'-[[3-(aminomethyl)phenyl]methyl]ethanimidamide |
CHEMBL107251 |
CHEBI:90721 |
1400W (dihydrochloride) |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of N-(3-(Aminomethyl)benzyl)acetamidine 2D Structure of N-(3-(Aminomethyl)benzyl)acetamidine](https://plantaedb.com/storage/docs/compounds/2023/07/n-3-aminomethylbenzylacetamidine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
10000 nM 10000 nM |
Potency Potency |
PMID: 20708825
PMID: 25682561 |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible |
330 nM |
IC50 |
PMID: 7623037
|
CHEMBL3568 | P29475 | Nitric-oxide synthase, brain |
7300 nM |
Ki |
PMID: 23305465
|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
316.2 nM 316.2 nM |
Potency Potency |
PMID: 17502413
PMID: 21970540 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.60% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.50% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.72% | 86.33% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.69% | 90.24% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 89.64% | 97.88% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.80% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.75% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.82% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 82.33% | 98.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.55% | 96.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.48% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.47% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.03% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crotalaria pallida |
Millettia erythrocalyx |
PubChem | 1433 |
NPASS | NPC469330 |
ChEMBL | CHEMBL107251 |
LOTUS | LTS0233925 |
wikiData | Q104968393 |