N-[3-[4-aminobutyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-3-(4-hydroxyphenyl)prop-2-enamide
Internal ID | 58449140-0d1c-483f-b524-d1b0dc715cd3 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | N-[3-[4-aminobutyl-[3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-3-(4-hydroxyphenyl)prop-2-enamide |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)NCCCN(CCCCN)C(=O)C=CC2=CC=C(C=C2)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC(=O)NCCCN(CCCCN)C(=O)C=CC2=CC=C(C=C2)O)O |
InChI | InChI=1S/C25H31N3O4/c26-16-1-2-18-28(25(32)15-9-21-6-12-23(30)13-7-21)19-3-17-27-24(31)14-8-20-4-10-22(29)11-5-20/h4-15,29-30H,1-3,16-19,26H2,(H,27,31) |
InChI Key | SFMLRCDOOPCKCM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H31N3O4 |
Molecular Weight | 437.50 g/mol |
Exact Mass | 437.23145648 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.20% | 99.17% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 90.55% | 85.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.53% | 96.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.73% | 90.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.61% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.20% | 95.56% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.12% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.02% | 89.67% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.08% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.73% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.01% | 86.33% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.34% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aphelandra chamissoniana |
Pterocarya fraxinifolia |
PubChem | 162925395 |
LOTUS | LTS0160884 |
wikiData | Q105251872 |