N-[3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide
| Internal ID | 619a968a-0347-4ba6-91a1-324e3f0f169e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > 2-heteroaryl carboxamides |
| IUPAC Name | N-[3-(2-amino-5-oxo-1H-imidazol-4-ylidene)-2-hydroxypropyl]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H12BrN5O3/c12-5-1-7(14-3-5)9(19)15-4-6(18)2-8-10(20)17-11(13)16-8/h1-3,6,14,18H,4H2,(H,15,19)(H3,13,16,17,20) |
| InChI Key | DGOLYPALKIXHIE-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H12BrN5O3 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.01235 g/mol |
| Topological Polar Surface Area (TPSA) | 133.00 Ų |
| XlogP | -0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.32% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.13% | 89.34% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.95% | 83.10% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.73% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.98% | 95.56% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 88.10% | 95.00% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 87.92% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.59% | 98.95% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.52% | 85.30% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.70% | 92.88% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 86.59% | 81.58% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.10% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.99% | 90.71% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 85.79% | 80.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.62% | 90.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.78% | 80.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.65% | 91.07% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.38% | 98.05% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.36% | 89.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.36% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162865809 |
| LOTUS | LTS0091854 |
| wikiData | Q104978943 |