N-(2-Oxotetrahydrofuran-3-YL)octanamide
| Internal ID | c649f845-9b8c-4b98-912c-36c45ce9c25b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
| IUPAC Name | N-[(3S)-2-oxooxolan-3-yl]octanamide |
| SMILES (Canonical) | CCCCCCCC(=O)NC1CCOC1=O |
| SMILES (Isomeric) | CCCCCCCC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C12H21NO3/c1-2-3-4-5-6-7-11(14)13-10-8-9-16-12(10)15/h10H,2-9H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChI Key | JKEJEOJPJVRHMQ-JTQLQIEISA-N |
| Popularity | 552 references in papers |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15214353 g/mol |
| Topological Polar Surface Area (TPSA) | 55.40 Ų |
| XlogP | 2.60 |
| 147852-84-4 |
| N-[(3S)-2-oxooxolan-3-yl]octanamide |
| N-(2-OXOTETRAHYDROFURAN-3-YL)OCTANAMIDE |
| C8-HSL |
| Octanoyl-L-homoserine lactone |
| Octanamide, N-[(3S)-tetrahydro-2-oxo-3-furanyl]- |
| CHEMBL259352 |
| (S)-N-(2-Oxotetrahydrofuran-3-yl)octanamide |
| N-[(3S)-Tetrahydro-2-oxo-3-furanyl]octanamide |
| HTF |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.09% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.81% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.67% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.03% | 91.11% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.20% | 92.50% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.01% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.65% | 97.25% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.33% | 92.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.69% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.14% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.60% | 99.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.43% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.12% | 98.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.09% | 94.33% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.82% | 94.66% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.81% | 95.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.06% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6914579 |
| LOTUS | LTS0057244 |
| wikiData | Q27097162 |