N-(2-methylpropyl)icosa-2,4,8-trienamide
Internal ID | f0ec4bfb-cb18-4338-9b62-caa7d442154a |
Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
IUPAC Name | N-(2-methylpropyl)icosa-2,4,8-trienamide |
SMILES (Canonical) | CCCCCCCCCCCC=CCCC=CC=CC(=O)NCC(C)C |
SMILES (Isomeric) | CCCCCCCCCCCC=CCCC=CC=CC(=O)NCC(C)C |
InChI | InChI=1S/C24H43NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(26)25-22-23(2)3/h14-15,18-21,23H,4-13,16-17,22H2,1-3H3,(H,25,26) |
InChI Key | WBBCNGSATYECFE-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H43NO |
Molecular Weight | 361.60 g/mol |
Exact Mass | 361.334464995 g/mol |
Topological Polar Surface Area (TPSA) | 29.10 Ų |
XlogP | 8.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.88% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 97.85% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.76% | 99.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.69% | 89.63% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.31% | 92.86% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.58% | 89.34% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.30% | 95.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.23% | 93.56% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 88.74% | 87.45% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 88.58% | 85.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.30% | 90.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.63% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.29% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.93% | 94.45% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.31% | 96.47% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.51% | 94.73% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 85.06% | 97.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.86% | 97.21% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.58% | 94.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.92% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.89% | 100.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.05% | 92.08% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.56% | 96.38% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.70% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper longum |
Piper nigrum |
Piper retrofractum |
PubChem | 85916327 |
LOTUS | LTS0047433 |
wikiData | Q105300602 |