N-(2-methylpropyl)hexadeca-2,9,12,14-tetraenamide
Internal ID | 5743b892-c67e-4980-bdfc-90482402f5c7 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
IUPAC Name | N-(2-methylpropyl)hexadeca-2,9,12,14-tetraenamide |
SMILES (Canonical) | CC=CC=CCC=CCCCCCC=CC(=O)NCC(C)C |
SMILES (Isomeric) | CC=CC=CCC=CCCCCCC=CC(=O)NCC(C)C |
InChI | InChI=1S/C20H33NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19(2)3/h4-7,9-10,16-17,19H,8,11-15,18H2,1-3H3,(H,21,22) |
InChI Key | TUOUAZDJHYHIRF-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H33NO |
Molecular Weight | 303.50 g/mol |
Exact Mass | 303.256214676 g/mol |
Topological Polar Surface Area (TPSA) | 29.10 Ų |
XlogP | 6.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.14% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.38% | 99.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.32% | 97.29% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.84% | 83.82% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 86.97% | 92.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.56% | 90.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.19% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.18% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.30% | 94.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.89% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.66% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.47% | 89.34% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.33% | 87.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.63% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.07% | 100.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.83% | 97.21% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.40% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Echinacea purpurea |
PubChem | 74932722 |
LOTUS | LTS0197823 |
wikiData | Q105264911 |