N-(2-methylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide
| Internal ID | 27764969-4998-4b55-aab4-48bb6087cc59 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid amides |
| IUPAC Name | N-(2-methylpropyl)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES (Canonical) | CC(C)CNC(=O)C=CC1=CC(=C(C(=C1)OC)OC)OC |
| SMILES (Isomeric) | CC(C)CNC(=O)C=CC1=CC(=C(C(=C1)OC)OC)OC |
| InChI | InChI=1S/C16H23NO4/c1-11(2)10-17-15(18)7-6-12-8-13(19-3)16(21-5)14(9-12)20-4/h6-9,11H,10H2,1-5H3,(H,17,18) |
| InChI Key | PMASCARXOAUEEW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 56.80 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.00% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.10% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.85% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.71% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.18% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.71% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.04% | 94.73% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.77% | 90.20% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.44% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.60% | 98.75% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.94% | 89.50% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.89% | 97.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.74% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.35% | 90.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.91% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.41% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Peperomia oreophila |
| PubChem | 72087002 |
| LOTUS | LTS0258764 |
| wikiData | Q105211360 |