N-(2-methylpropyl)-2,4-tetradecadiene-8,10-diynamide
| Internal ID | fc401352-57fe-497a-9f6f-5bd2be8f5edf |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-(2-methylpropyl)tetradeca-2,4-dien-8,10-diynamide |
| SMILES (Canonical) | CCCC#CC#CCCC=CC=CC(=O)NCC(C)C |
| SMILES (Isomeric) | CCCC#CC#CCCC=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C18H25NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(20)19-16-17(2)3/h12-15,17H,4-5,10-11,16H2,1-3H3,(H,19,20) |
| InChI Key | CAZNLADLZFVEBY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.193614421 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.64% | 98.95% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.50% | 96.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.04% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.05% | 89.34% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.72% | 95.71% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.31% | 89.63% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.97% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.70% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.50% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.18% | 99.17% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.74% | 97.47% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.99% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.16% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.99% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.75% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.22% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.15% | 94.73% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.95% | 92.86% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.73% | 94.33% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 81.72% | 98.57% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.69% | 98.59% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.38% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.00% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea erba-rotta |
| Achillea millefolium |
| PubChem | 441492 |
| LOTUS | LTS0275178 |
| wikiData | Q104952132 |