N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzamide
| Internal ID | 46150470-8ec0-4fa7-872c-e25876ea10b4 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzylethers |
| IUPAC Name | N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES (Canonical) | COC1=CC=C(C=C1)C(CNC(=O)C2=CC=CC=C2)OC |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C(CNC(=O)C2=CC=CC=C2)OC |
| InChI | InChI=1S/C17H19NO3/c1-20-15-10-8-13(9-11-15)16(21-2)12-18-17(19)14-6-4-3-5-7-14/h3-11,16H,12H2,1-2H3,(H,18,19) |
| InChI Key | GASAZUPHPROROJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 47.60 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-methoxy-2-4-methoxyphenylethylbenzamide.jpg "2D Structure of N-[2-methoxy-2-(4-methoxyphenyl)ethyl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 96.99% | 87.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.91% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.55% | 90.17% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.97% | 81.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.85% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.07% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.13% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.04% | 99.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.81% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 87.89% | 89.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.87% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.08% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.65% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.04% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.01% | 91.07% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.85% | 100.00% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.56% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum ailanthoides |
| PubChem | 78413246 |
| LOTUS | LTS0209356 |
| wikiData | Q105005604 |