N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-methylprop-2-enamide
| Internal ID | 60b706dd-c385-4910-be52-c6e8a7ae670e |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-methylprop-2-enamide |
| SMILES (Canonical) | CN(CCO)C(=O)C=CC1=CC=C(C=C1)O |
| SMILES (Isomeric) | CN(CCO)C(=O)C=CC1=CC=C(C=C1)O |
| InChI | InChI=1S/C12H15NO3/c1-13(8-9-14)12(16)7-4-10-2-5-11(15)6-3-10/h2-7,14-15H,8-9H2,1H3 |
| InChI Key | WAKLGDBEFNQZHV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.99% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.03% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.18% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.01% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.05% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.12% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.24% | 91.11% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.69% | 91.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.55% | 89.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.42% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.58% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.58% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.10% | 94.73% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.59% | 98.35% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.87% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrophleum chlorostachys |
| PubChem | 285355 |
| LOTUS | LTS0090728 |
| wikiData | Q105300289 |