N-[2-(4-methoxyphenyl)ethyl]-2-methylbut-2-enamide
| Internal ID | 4a0ee0b4-89b9-4783-b611-b88864233234 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-methylbut-2-enamide |
| SMILES (Canonical) | CC=C(C)C(=O)NCCC1=CC=C(C=C1)OC |
| SMILES (Isomeric) | CC=C(C)C(=O)NCCC1=CC=C(C=C1)OC |
| InChI | InChI=1S/C14H19NO2/c1-4-11(2)14(16)15-10-9-12-5-7-13(17-3)8-6-12/h4-8H,9-10H2,1-3H3,(H,15,16) |
| InChI Key | KGZJCONTSAVXLQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of N-[2-(4-methoxyphenyl)ethyl]-2-methylbut-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-4-methoxyphenylethyl-2-methylbut-2-enamide.jpg "2D Structure of N-[2-(4-methoxyphenyl)ethyl]-2-methylbut-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.18% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.52% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.31% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.73% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.17% | 90.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.93% | 94.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.73% | 97.21% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.59% | 95.50% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 88.58% | 89.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.50% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.22% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.24% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.96% | 95.56% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.91% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.27% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.89% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.55% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.92% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.49% | 94.73% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.42% | 90.24% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.28% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena lansium |
| PubChem | 123793891 |
| LOTUS | LTS0274666 |
| wikiData | Q105141050 |